Molecule Details
| InChIKey | RLRQXKXWZNPYRB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Eciruciclib |
| Canonical SMILES | CCN1CCN(Cc2ccc(Nc3ncc(F)c(-c4ccc5nn(C)c(C(C)C)c5c4)n3)nc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.91 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21597 |
|---|---|
| Drug Name | Eciruciclib |
| CAS Number | 1868086-40-1 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Eciruciclib is a small molecule drug. The usage of the INN stem '-ciclib' in the name indicates that Eciruciclib is a cyclin dependant kinase inhibitor. Eciruciclib has a monoisotopic molecular weight of 488.28 Da. |
Cross-references: BindingDB: 50644903 CHEMBL5095060