Molecule Details
| InChIKey | RKLNONIVDFXQRX-UHFFFAOYSA-N |
|---|---|
| Compound Name | Bromperidol |
| Canonical SMILES | O=C(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)c1ccc(F)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.94 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12401 |
|---|---|
| Drug Name | Bromperidol |
| CAS Number | 10457-90-6 |
| Groups | approved withdrawn |
| ATC Codes | N05AD06 |
| Description | Bromperidol has been used in trials studying the treatment of Dementia, Depression, Schizophrenia, Anxiety Disorders, and Psychosomatic Disorders, among others. |
Categories: Antipsychotic Agents Butyrophenone Derivatives Butyrophenones Central Nervous System Agents Central Nervous System Depressants Ketones Nervous System Neurotoxic agents Psycholeptics Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 81484 ChEBI: 31305 CHEMBL28218 ChemSpider: 2354 PubChem:2448 PubChem:347828647 RxCUI: 19777 Wikipedia: Bromperidol ZINC: ZINC000000601270
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.2 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 8.8 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P9WFK7 | eis | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF17668 PF13527 PF13530 | 6.5 | IC50 | ChEMBL;BindingDB |