Molecule Details
| InChIKey | RJMIEHBSYVWVIN-UHFFFAOYSA-N |
|---|---|
| Compound Name | Indoprofen |
| Canonical SMILES | CC(C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.32 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08951 |
|---|---|
| Drug Name | Indoprofen |
| CAS Number | 31842-01-0 |
| Groups | approved withdrawn |
| ATC Codes | M01AE10 |
| Description | A drug that has analgesic and anti-inflammatory properties. Following reports of adverse reactions including reports of carcinogenicity in animal studies it was withdrawn from the market worldwide. |
Categories: Acids, Carbocyclic Agents causing hyperkalemia Agents that produce hypertension Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents Cyclooxygenase Inhibitors Enzyme Inhibitors Heterocyclic Compounds, Fused-Ring Isoindoles Musculo-Skeletal System Nephrotoxic agents Non COX-2 selective NSAIDS Peripheral Nervous System Agents Phenylpropionates Propionates Sensory System Agents
Cross-references: BindingDB: 50233673 ChEBI: 76162 CHEMBL15870 ChemSpider: 3587 D04530 PubChem:3718 PubChem:310264916 Wikipedia: Indoprofen
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P55211 | CASP9 | Homo sapiens | Human | PF00619 PF00656 | 6.5 | IC50 | BindingDB |
| Q9UBN7 | HDAC6 | Homo sapiens | Human | PF00850 PF02148 | 6.3 | IC50 | ChEMBL |
| P49662 | CASP4 | Homo sapiens | Human | PF00619 PF00656 | 6.2 | IC50 | BindingDB |
| P51878 | CASP5 | Homo sapiens | Human | PF00619 PF00656 | 6.2 | IC50 | BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P07148 | FABP1 | Fatty acid-binding protein, liver | inhibitor | targets |
| P14618 | PKM | Pyruvate kinase PKM | inhibitor | targets |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P25024 | CXCR1 | C-X-C chemokine receptor type 1 | inhibitor | targets |
| P25025 | CXCR2 | C-X-C chemokine receptor type 2 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |