Molecule Details
| InChIKey | REOZWEGFPHTFEI-JKSUJKDBSA-N |
|---|---|
| Compound Name | Cannabidivarin |
| Canonical SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.44 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14050 |
|---|---|
| Drug Name | Cannabidivarin |
| CAS Number | 24274-48-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Cannabidivarin, also known as cannabidivarol or CBDV, is a non-psychoactive cannabinoid found within [DB14009]. It is one of over 100 cannabinoids identified from the Cannabis plant that can modulate the physiological activity of cannabis, or marijuana [A32584]. Compared to its homolog, [DB09061], C... |
Categories: Anticonvulsants Central Nervous System Depressants Terpenes
Cross-references: CHEMBL2387742 ChemSpider: 9776426 Wikipedia: Cannabidivarin ZINC: ZINC000005844413
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P04798 | CYP1A1 | Homo sapiens | Human | PF00067 | 7.2 | IC50 | ChEMBL;BindingDB |
| P35372 | OPRM1 | Homo sapiens | Human | PF00001 | 6.2 | IC50 | ChEMBL |
| P34972 | CNR2 | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL;BindingDB |
| Q7Z2W7 | TRPM8 | Homo sapiens | Human | PF00520 PF18139 PF25508 | 6.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (4)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O75762 | TRPA1 | Transient receptor potential cation channel subfamily A member 1 | agonist | targets |
| Q8NER1 | TRPV1 | Transient receptor potential cation channel subfamily V member 1 | agonist | targets |
| Q9Y5S1 | TRPV2 | Transient receptor potential cation channel subfamily V member 2 | agonist | targets |
| F5GY58 | F5GY58 | Diacylglycerol lipase alpha | inhibitor | targets |