Molecule Details
| InChIKey | RDONXGFGWSSFMY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Mivebresib |
| Canonical SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3[nH]ccc23)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.89 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21300 |
|---|---|
| Drug Name | Mivebresib |
| CAS Number | 1445993-26-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Mivebresib is a small molecule drug. The usage of the INN stem '-bresib' in the name indicates that Mivebresib is a inhibitor of the bromodomain and extra-terminal motif (BET) family of bromodomain (BRD) protein, antineoplastic. Mivebresib is under investigation in clinical trial NCT04480086 (Safety... |
Categories: Amides Pyridines Sulfones Sulfur Compounds
Cross-references: BindingDB: 220447 CHEMBL3987016 PDB: 8NG ZINC: ZINC000146486516
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P25440 | BRD2 | Homo sapiens | Human | PF17035 PF00439 | 9.0 | Ki | ChEMBL;BindingDB |
| Q58F21 | BRDT | Homo sapiens | Human | PF17035 PF17105 PF00439 | 8.7 | Ki | ChEMBL;BindingDB |
| O60885 | BRD4 | Homo sapiens | Human | PF17035 PF17105 PF00439 | 8.5 | IC50 | ChEMBL;BindingDB |
| Q15059 | BRD3 | Homo sapiens | Human | PF17035 PF00439 | 7.9 | Ki | ChEMBL;BindingDB |
| Q09472 | EP300 | Homo sapiens | Human | PF00439 PF09030 PF08214 PF02172 PF23570 PF06001 PF02135 PF00569 | 7.1 | IC50 | ChEMBL;BindingDB |
| P30536 | TSPO | Homo sapiens | Human | PF03073 | 6.1 | IC50 | ChEMBL;BindingDB |