Molecule Details
| InChIKey | RCLQNICOARASSR-SECBINFHSA-N |
|---|---|
| Canonical SMILES | Cn1c(=O)c(F)c(Nc2ccc(I)cc2F)c2c(=O)n(C[C@@H](O)CO)cnc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.1 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12241 |
|---|---|
| Drug Name | TAK-733 |
| CAS Number | 1035555-63-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | TAK-733 has been used in trials studying the treatment of Advanced Metastatic Melanoma, Advanced Nonhematologic Malignancies, and Advanced Non-hematologic Malignancies. |
Categories: Pyridines Pyrimidines
Cross-references: BindingDB: 50337926 CHEMBL1615025 ChemSpider: 26327014 PDB: IZG PubChem:24963252 PubChem:347828519 Wikipedia: MEK_inhibitor ZINC: ZINC000043196550