Molecule Details
| InChIKey | RBSGUQYXRDKPAE-QFIPXVFZSA-N |
|---|---|
| Canonical SMILES | CC(C)(Cc1ccc(Oc2ccc(C(N)=O)cn2)cc1)NC[C@H](O)COc1cccc2[nH]c3ccccc3c12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 10.78 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12858 |
|---|---|
| Drug Name | LY-377604 |
| CAS Number | 204592-94-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ly377604 has been used in trials studying the treatment of Obesity. |
Cross-references: BindingDB: 50379086 CHEMBL2012520 ChemSpider: 8025412 PubChem:9849699 PubChem:347829017 ZINC: ZINC000002005848
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P13945 | ADRB3 | Beta-3 adrenergic receptor | agonist | targets |