Molecule Details
| InChIKey | QXZGBUJJYSLZLT-FDISYFBBSA-N |
|---|---|
| Compound Name | Bradykinin |
| Canonical SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 11.0 |
| Source | TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12126 |
|---|---|
| Drug Name | Bradykinin |
| CAS Number | 58-82-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Bradykinin has been investigated for the basic science and treatment of Hypertension and Diabetes Type 2. |
Categories: Amino Acids, Peptides, and Proteins Autacoids Biological Factors Bradykinin, agonists Cardiovascular Agents Inflammation Mediators Intercellular Signaling Peptides and Proteins Kinins Nerve Tissue Proteins Neuropeptides Oligopeptides Peptides Proteins Vasodilating Agents
Cross-references: BindingDB: 50049949 ChEBI: 3165 CHEMBL406291 ChemSpider: 388341 C00306 PharmGKB: PA166109574 PubChem:439201 PubChem:347828425 Wikipedia: Bradykinin
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P30411 | BDKRB2 | B2 bradykinin receptor | inhibitor | targets |