Molecule Details
| InChIKey | QWLNINWUBHHOLU-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | Cn1c(=O)c(C(=O)NCCO)c(O)c2ncc(Cc3ccc(F)cc3)cc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.09 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13119 |
|---|---|
| Drug Name | GSK-364735 |
| CAS Number | 863434-13-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | GSK-364735 (Naphthyridinone) has been used in trials studying the treatment of HIV-1 Infection and Infection, Human Immunodeficiency Virus. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50045107 CHEMBL1256978 ChemSpider: 26366844 PubChem:54718859 PubChem:347829242 ZINC: ZINC000102403694