Molecule Details
| InChIKey | QUMCIHKVKQYNPA-RUZDIDTESA-N |
|---|---|
| Canonical SMILES | CC[C@@H]1c2nnc(C)n2-c2cnc(Nc3ccc(C(=O)NC4CCN(C)CC4)cc3OC)nc2N1CC1CCCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.3 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB23606 |
|---|---|
| Drug Name | WNY0824 |
| CAS Number | 2412707-81-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | WNY0824 is a preclinical small molecule drug being investigated for the treatment of Castration-Resistant Prostrate Cancer (CRPC). [A274253] It is a dual inhibitor of PLK-1 and BRET-4, which have both been found to be involved in CRPC via suppression of AR/MYC-mediated transcription. [A274258] |
Cross-references: BindingDB: 50551271 CHEMBL4747491