Molecule Details
| InChIKey | QRJJEGAJXVEBNE-HKOYGPOVSA-N |
|---|---|
| Compound Name | Oxiconazole |
| Canonical SMILES | Clc1ccc(CO/N=C(\Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 9 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.4 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00239 |
|---|---|
| Drug Name | Oxiconazole |
| CAS Number | 64211-45-6 |
| Groups | approved |
| ATC Codes | D01AC11 G01AF17 G01AF20 |
| Description | Oxiconazole is an antifungal agent that is commonly found in topical formulations. It is marketed under the brand names Oxistat and Oxistat, and is used in the treatment of various skin infections such as athlete's foot, jock itch and ringworm. |
Categories: Anti-Infective Agents Antifungal Agents Antifungals for Dermatological Use Antifungals for Topical Use Azole Antifungals Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Substrates Dermatologicals Genito Urinary System and Sex Hormones Gynecological Antiinfectives and Antiseptics Imidazole Derivatives Imidazole and Triazole Derivatives
Cross-references: BindingDB: 50051844 ChEBI: 7825 CHEMBL1262 ChemSpider: 4510239 Drugs Product Database (DPD): 11326 C08074 D08313 PharmGKB: PA164754742 PubChem:5353853 PubChem:46504752 RxCUI: 32638 Therapeutic Targets Database: DAP001204 Wikipedia: Oxiconazole ZINC: ZINC000003873295
Target Activities (9)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P33261 | CYP2C19 | Homo sapiens | Human | PF00067 | 7.4 | IC50 | ChEMBL |
| P08684 | CYP3A4 | Homo sapiens | Human | PF00067 | 7.0 | IC50 | ChEMBL |
| P0DMS8 | ADORA3 | Homo sapiens | Human | PF00001 | 6.3 | IC50 | ChEMBL |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 6.2 | IC50 | ChEMBL |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P24557 | TBXAS1 | Homo sapiens | Human | PF00067 | 6.2 | IC50 | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |
| P10635 | CYP2D6 | Homo sapiens | Human | PF00067 | 6.0 | IC50 | ChEMBL |
DrugBank Target Actions (5)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P10613 | ERG11 | Lanosterol 14-alpha demethylase | inhibitor | targets |
| Q04782 | ERG7 | Lanosterol synthase | inhibitor | targets |
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | partial agonist | targets |