Molecule Details
| InChIKey | QQMKTHUGOQDEIL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Zegocractin |
| Canonical SMILES | Cc1cccc(F)c1C(=O)Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)O3)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.48 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16466 |
|---|---|
| Drug Name | CM4620 |
| CAS Number | 1713240-67-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CM4620 (Zegocractin), is under investigation in multiple clinical trials, including NCT04195347 (pancreatitis due to asparaginase), NCT03709342 (PK/PD study in acute pancreatitis), NCT03401190 and NCT04681066 (pancreatitis and SIRS), and NCT04661540 (critical COVID-19 pneumonia). |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates Experimental Unapproved Treatments for COVID-19
Cross-references: CHEMBL4753998 ChemSpider: 58810276