Molecule Details
| InChIKey | QMNFFXRFOJIOKZ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Cycloguanil |
| Canonical SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.69 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14763 |
|---|---|
| Drug Name | Cycloguanil |
| CAS Number | 516-21-2 |
| Groups | approved |
| ATC Codes | P01BB02 |
| Description | Cycloguanil is the active metabolite of [proguanil]. |
Categories: Amidines Anti-Infective Agents Antimalarials Antiparasitic Agents Antiparasitic Products, Insecticides and Repellents Antiprotozoals Biguanides Enzyme Inhibitors Folic Acid Antagonists Guanidines
Cross-references: BindingDB: 18792 ChEBI: 135029 CHEMBL747 ChemSpider: 8697 PDB: 1CY Wikipedia: Cycloguanil ZINC: ZINC000000001233
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9HBH1 | Peptide deformylase, mitochondrial | inhibitor | targets |