Molecule Details
| InChIKey | QGXBDMJGAMFCBF-BNSUEQOYSA-N |
|---|---|
| Canonical SMILES | C[C@]12CC[C@@H](O)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.32 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB02854 |
|---|---|
| Drug Name | Aetiocholanolone |
| CAS Number | 53-42-9 |
| Groups | experimental |
| ATC Codes | nan |
| Description | The 5-beta-reduced isomer of androsterone. Etiocholanolone is a major metabolite of testosterone and androstenedione in many mammalian species including humans. It is excreted in the urine. [PubChem] |
Cross-references: BindingDB: 50191348 ChEBI: 28195 CHEMBL85799 ChemSpider: 5669 C04373 PDB: AE2 PubChem:5880 PubChem:46507911 Wikipedia: Etiocholanolone ZINC: ZINC000003875364