Molecule Details
| InChIKey | QCCHBHSAIQIQGO-UHFFFAOYSA-N |
|---|---|
| Compound Name | Imirestat |
| Canonical SMILES | O=C1NC(=O)C2(N1)c1cc(F)ccc1-c1ccc(F)cc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.3 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19544 |
|---|---|
| Drug Name | Imirestat |
| CAS Number | 89391-50-4 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Imirestat is a small molecule drug. The usage of the INN stem '-restat' in the name indicates that Imirestat is a aldose reductase inhibitor. Imirestat has a monoisotopic molecular weight of 286.06 Da. |
Categories: Aldehyde Reductase, antagonists & inhibitors Imidazoles Imidazolidines
Cross-references: BindingDB: 50010283 CHEMBL269455 ZINC: ZINC000000003724
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P15121 | AKR1B1 | Aldo-keto reductase family 1 member B1 | inhibitor | targets |