Molecule Details
| InChIKey | PZRHRDRVRGEVNW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Milrinone |
| Canonical SMILES | Cc1[nH]c(=O)c(C#N)cc1-c1ccncc1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.32 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00235 |
|---|---|
| Drug Name | Milrinone |
| CAS Number | 78415-72-2 |
| Groups | approved investigational |
| ATC Codes | C01CE02 |
| Description | Heart failure is a multifactorial condition that affects roughly 1-2% of the adult population. Often the result of long-term myocardial ischemia, cardiomyopathy, or other cardiac insults, heart failure results from an inability of the heart to perfuse peripheral tissues with sufficient oxygen and me... |
Categories: Amines Aminopyridines Cardiac Stimulants Excl. Cardiac Glycosides Cardiac Therapy Cardiotonic Agents Cardiovascular Agents Compounds used in a research, industrial, or household setting Drugs that are Mainly Renally Excreted Enzyme Inhibitors Hematologic Agents Phosphodiesterase 3 Inhibitors Phosphodiesterase Inhibitors Protective Agents Pyridines Vasodilating Agents
Cross-references: BindingDB: 15296 ChEBI: 50693 CHEMBL189 ChemSpider: 4052 Drugs Product Database (DPD): 1216 C07224 D00417 PDB: MIL PharmGKB: PA164749171 PubChem:4197 PubChem:46507838 RxCUI: 52769 Therapeutic Targets Database: DAP000150 Wikipedia: Milrinone ZINC: ZINC000009224016
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q13370 | PDE3B | Homo sapiens | Human | PF00233 | 6.4 | IC50 | ChEMBL;BindingDB |
| Q14432 | PDE3A | Homo sapiens | Human | PF00233 | 6.4 | IC50 | ChEMBL;BindingDB |
| O76074 | PDE5A | Homo sapiens | Human | PF01590 PF00233 | 6.1 | IC50 | ChEMBL;BindingDB |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | Clinical | TTD_MultiTarget | TTD_MultiTarget |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q14432 | PDE3A | cGMP-inhibited 3',5'-cyclic phosphodiesterase 3A | inhibitor | targets |