Molecule Details
| InChIKey | PYZOVVQJTLOHDG-FQEVSTJZSA-N |
|---|---|
| Canonical SMILES | CN1Cc2cc(C(=O)N3CCC(C4CCNCC4)CC3)ccc2N[C@@H](CC(=O)O)C1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.14 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20872 |
|---|---|
| Drug Name | Lotrafiban |
| CAS Number | 171049-14-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Lotrafiban is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Lotrafiban is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Lotrafiban has a monoisotopic molecular weight of 428.24 Da. |
Categories: Benzazepines Heterocyclic Compounds, Fused-Ring Platelet Glycoprotein GPIIb-IIIa Complex, antagonists & inhibitors
Cross-references: BindingDB: 50054825 CHEMBL356301 PDB: MWI ZINC: ZINC000003812598