Molecule Details
| InChIKey | PYSCVJMLJRHJGJ-OYNCUSHFSA-N |
|---|---|
| Canonical SMILES | Clc1ccc(OC[C@@H]2C[C@H]3C[C@H]3N2)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.82 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19134 |
|---|---|
| Drug Name | Ropanicant |
| CAS Number | 2414674-70-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ropanicant is under investigation in clinical trial NCT06126497 (Study Evaluating Safety and Efficacy of Ropanicant in MDD Patients). |
Cross-references: CHEMBL4650579 ChemSpider: 115009609