Molecule Details
| InChIKey | PWBHUSLMHZLGRN-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | O=C1CCC(N2Cc3cc(CNC(=O)C(F)(F)c4ccc(Cl)cc4)ccc3C2=O)C(=O)N1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.08 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19242 |
|---|---|
| Drug Name | Eragidomide |
| CAS Number | 1860875-51-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Eragidomide is under investigation in clinical trial NCT04297124 (A Study to Evaluate the Metabolism and Excretion of [14C]-CC-90009 in Healthy Male Subjects). |
Categories: Acetates Acids, Acyclic Amides Heterocyclic Compounds, Fused-Ring Piperidines
Cross-references: CHEMBL4742712 ChemSpider: 88295982