Molecule Details
| InChIKey | PRAAPINBUWJLGA-UHFFFAOYSA-N |
|---|---|
| Compound Name | Telaglenastat |
| Canonical SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3ccccn3)s2)nn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.8 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15232 |
|---|---|
| Drug Name | Telaglenastat |
| CAS Number | 1439399-58-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Telaglenastat is under investigation in clinical trial NCT02071862 (Study of the Glutaminase Inhibitor CB-839 in Solid Tumors). |
Categories: Acetamides Amides Benzene Derivatives Sulfur Compounds Thiazoles
Cross-references: BindingDB: 109086 CHEMBL3639788 ChemSpider: 34959639 ZINC: ZINC000169698697