Molecule Details
| InChIKey | POZRVZJJTULAOH-LHZXLZLDSA-N |
|---|---|
| Compound Name | Danazol |
| Canonical SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=Cc5oncc5C[C@]4(C)[C@H]3CC[C@@]21C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.48 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01406 |
|---|---|
| Drug Name | Danazol |
| CAS Number | 17230-88-5 |
| Groups | approved investigational |
| ATC Codes | G03XA01 |
| Description | A synthetic steroid with antigonadotropic and anti-estrogenic activities that acts as an anterior pituitary suppressant by inhibiting the pituitary output of gonadotropins. It possesses some androgenic properties. Danazol has been used in the treatment of endometriosis and some benign breast disorde... |
Categories: Androgens Antigonadotropins and Similar Agents Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (moderate) Cytochrome P-450 CYP3A4 Inhibitors (strong) Cytochrome P-450 Enzyme Inhibitors Estrogen Antagonists Fused-Ring Compounds Genito Urinary System and Sex Hormones Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists Hyperglycemia-Associated Agents Pregnadienes Pregnanes Sex Hormones and Modulators of the Genital System Steroids Thyroxine-binding globulin inhibitors
Cross-references: BindingDB: 50423541 ChEBI: 4315 CHEMBL1479 ChemSpider: 26436 Drugs Product Database (DPD): 2282 D00289 PDB: QA1 PharmGKB: PA164749056 PubChem:28417 PubChem:46506475 RxCUI: 3102 Therapeutic Targets Database: DAP001017 Wikipedia: Danazol ZINC: ZINC000003881958
Target Activities (3)
DrugBank Target Actions (9)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04278 | SHBG | Sex hormone-binding globulin | antagonist | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P11511 | CYP19A1 | Aromatase | inhibitor | enzymes |
| P03372 | ESR1 | Estrogen receptor | agonist | targets |
| P06401 | PGR | Progesterone receptor | agonist | targets |
| P10275 | AR | Androgen receptor | agonist | targets |
| P13500 | CCL2 | C-C motif chemokine 2 | inhibitor | targets |
| P30968 | GNRHR | Gonadotropin-releasing hormone receptor | negative modulator | targets |
| Q96P88 | Q96P88 | Putative gonadotropin-releasing hormone II receptor | negative modulator | targets |