Molecule Details
| InChIKey | PNDKCRDVVKJPKG-WHERJAGFSA-N |
|---|---|
| Compound Name | Cenicriviroc |
| Canonical SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)/C=C(/C(=O)Nc2ccc([S@@+]([O-])Cc4cncn4CCC)cc2)CCCN3CC(C)C)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.62 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11758 |
|---|---|
| Drug Name | Cenicriviroc |
| CAS Number | 497223-25-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Cenicriviroc has been used in trials studying the treatment of HIV-infection/AIDS, AIDS Dementia Complex, Nonalcoholic Steatohepatitis, Human Immunodeficiency Virus, and HIV-1-Associated Cognitive Motor Complex. |
Categories: Anti-HIV Agents Anti-Infective Agents Anti-Retroviral Agents Antiviral Agents CCR5 Receptor Antagonists Receptors, CCR2, antagonists & inhibitors Sulfur Compounds
Cross-references: CHEMBL2110727 ChemSpider: 9460783 PubChem:11285792 PubChem:347828112 Wikipedia: Cenicriviroc