Molecule Details
| InChIKey | PNCPYILNMDWPEY-QGZVFWFLSA-N |
|---|---|
| Compound Name | Silodosin |
| Canonical SMILES | C[C@H](Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1ccccc1OCC(F)(F)F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 13 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.88 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06207 |
|---|---|
| Drug Name | Silodosin |
| CAS Number | 160970-54-7 |
| Groups | approved investigational |
| ATC Codes | G04CA04 |
| Description | Silodosin is a selective antagonist of alpha(α)-1 adrenergic receptors that binds to the α<sub>1A</sub> subtype with the highest affinity. α1-adrenergic receptors regulate smooth muscle tone in the bladder neck, prostate, and prostatic urethra: the α<sub>1A</sub> subtype accounts for approximately 7... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Drugs Used in Benign Prostatic Hypertrophy Genito Urinary System and Sex Hormones Genitourinary Agents Heterocyclic Compounds, Fused-Ring Neurotransmitter Agents P-glycoprotein substrates Peripheral alpha-1 blockers Selective Alfa-1-adrenergic Blocking Agents UGT2B7 substrates Urological Agents Urologicals
Cross-references: BindingDB: 50160154 ChEBI: 135929 CHEMBL24778 ChemSpider: 4471557 Drugs Product Database (DPD): 20659 D01965 PDB: A1EMV PharmGKB: PA165291889 PubChem:5312125 PubChem:175427058 RxCUI: 720825 Wikipedia: Silodosin ZINC: ZINC000003806063
Target Activities (13)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.7 | IC50 | ChEMBL;BindingDB |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 7.9 | IC50 | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 7.3 | Ki | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.1 | Ki | ChEMBL |
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 7.1 | IC50 | ChEMBL |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 7.0 | Ki | ChEMBL |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 6.8 | IC50 | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| P28222 | HTR1B | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05091 | ALDH2 | Aldehyde dehydrogenase, mitochondrial | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P14550 | AKR1A1 | Aldo-keto reductase family 1 member A1 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P25100 | ADRA1D | Alpha-1D adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | antagonist | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | antagonist | targets |
| Q12809 | KCNH2 | HERG human cardiac K+ channel | blocker | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| P21439 | P21439 | Phosphatidylcholine translocator ABCB4 | substrate | transporters |