Molecule Details
| InChIKey | PLHJCIYEEKOWNM-HHHXNRCGSA-N |
|---|---|
| Compound Name | Tipifarnib |
| Canonical SMILES | Cn1cncc1[C@@](N)(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2C |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.42 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04960 |
|---|---|
| Drug Name | Tipifarnib |
| CAS Number | 192185-72-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tipifarnib (R-115777) is a substance that is being studied in the treatment of acute myeloid leukemia (AML) and other types of cancer. It belongs to the family of drugs called farnesyltransferase inhibitors. It is also called Zarnestra. In June 2005, the FDA issued a Not Approvable Letter for Zarnes... |
Categories: Antineoplastic Agents Heterocyclic Compounds, Fused-Ring P-glycoprotein inhibitors Quinolines
Cross-references: BindingDB: 50370385 ChEBI: 141969 CHEMBL289228 ChemSpider: 140122 PDB: JAN PubChem:159324 PubChem:175426920 Wikipedia: Tipifarnib ZINC: ZINC000024809155
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P49354 | FNTA | Homo sapiens | Human | PF01239 | 9.1 | pIC50 | TTD_MultiTarget |
| P49356 | FNTB | Homo sapiens | Human | PF00432 | 9.1 | IC50 | ChEMBL;BindingDB |
| Q5E175 | rhlE | Aliivibrio fischeri (strain ATCC 700601 / ES114) | Pathogen | PF00270 PF00271 | 7.8 | IC50 | BindingDB |
| Q5EI73 | Plasmodium falciparum | Pathogen | PF01239 | 7.8 | IC50 | ChEMBL |
DrugBank Target Actions (4)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P14324 | FDPS | Farnesyl pyrophosphate synthase | inhibitor | targets |
| P49354 | FNTA | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha | modulator | targets |
| P49356 | FNTB | Protein farnesyltransferase subunit beta | modulator | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |