Molecule Details
| InChIKey | PKKNCEXEVUFFFI-UHFFFAOYSA-N |
|---|---|
| Compound Name | Nevanimibe |
| Canonical SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2ccc(N(C)C)cc2)CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.07 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16254 |
|---|---|
| Drug Name | Nevanimibe |
| CAS Number | 133825-80-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Nevanimibe is under investigation in clinical trial NCT03053271 (A Study of ATR-101 for the Treatment of Endogenous Cushing's Syndrome). |
Categories: Amides Benzene Derivatives
Cross-references: BindingDB: 50041735 CHEMBL46423 ChemSpider: 116346 PDB: ROV