Molecule Details
| InChIKey | PJTGSIKANITYOO-RCOXNQKVSA-N |
|---|---|
| Canonical SMILES | CC(C)N(C)[C@@H]1CC[C@H](N2CC[C@H](Nc3ncnc4ccc(C(F)(F)F)cc34)C2=O)[C@H](NS(C)(=O)=O)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.97 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19004 |
|---|---|
| Drug Name | BMS-741672 |
| CAS Number | 1386991-77-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | BMS-741672 is under investigation in clinical trial NCT00699790 (Proof of Confidence Study of CCR2 Antagonist (BMS-741672) in Insulin Resistance). |
Cross-references: BindingDB: 50509862 CHEMBL4457723 ChemSpider: 129186570