Molecule Details
| InChIKey | PGNHBJGIQAEIHD-UHFFFAOYSA-N |
|---|---|
| Compound Name | 1-(7-Benzofuranyl)-4-((5-(4-fluorophenyl)-1H-pyrrol-2-yl)methyl)piperazine |
| Canonical SMILES | Fc1ccc(-c2ccc(CN3CCN(c4cccc5ccoc45)CC3)[nH]2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.1 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19875 |
|---|---|
| Drug Name | Elopiprazole |
| CAS Number | 115464-77-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Elopiprazole is a small molecule drug. The usage of the INN stem '-prazole' in the name indicates that Elopiprazole is a benzimidazole derivative antiulcer medication. Elopiprazole has a monoisotopic molecular weight of 375.17 Da. |
Cross-references: BindingDB: 50020174 CHEMBL292187