Molecule Details
| InChIKey | PFWVGKROPKKEDW-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CC(C)(C)NC(=O)c1ccc(Oc2cc(F)c(CC(=O)O)cc2Cl)c(NS(=O)(=O)c2ccc(C3CC3)cc2Cl)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.12 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12272 |
|---|---|
| Drug Name | Vidupiprant |
| CAS Number | 1169483-24-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Vidupiprant has been used in trials studying the treatment and basic science of Asthma. |
Categories: Acids, Carbocyclic Amides Sulfones Sulfur Compounds
Cross-references: BindingDB: 50363928 CHEMBL1951575 ChemSpider: 28497640 PubChem:42641863 PubChem:347828543 ZINC: ZINC000043206238