Molecule Details
| InChIKey | PFGWGEPQIUAZME-NXSMLHPHSA-N |
|---|---|
| Compound Name | Saralasin |
| Canonical SMILES | CNCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)O)C(C)C)C(C)C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.41 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06763 |
|---|---|
| Drug Name | Saralasin |
| CAS Number | 34273-10-4 |
| Groups | experimental |
| ATC Codes | nan |
| Description | nan |
Categories: Agents Acting on the Renin-Angiotensin System Agents causing hyperkalemia Agents that produce hypertension Amino Acids, Peptides, and Proteins Angiotensin Receptor Antagonists Angiotensins Autacoids Biological Factors Inflammation Mediators Oligopeptides Peptides
Cross-references: BindingDB: 50009338 ChEBI: 135894 CHEMBL938 ChemSpider: 4884380 RxCUI: 9556 Wikipedia: Saralasin ZINC: ZINC000169289386