Molecule Details
| InChIKey | OUJTZYPIHDYQMC-LJQANCHMSA-N |
|---|---|
| Compound Name | Ambrisentan |
| Canonical SMILES | COC(c1ccccc1)(c1ccccc1)[C@H](Oc1nc(C)cc(C)n1)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.86 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06403 |
|---|---|
| Drug Name | Ambrisentan |
| CAS Number | 177036-94-1 |
| Groups | approved investigational |
| ATC Codes | C02KX02 C02KX52 |
| Description | Ambrisentan is an orally active selective type A endothelin receptor antagonist indicated for the treatment of pulmonary arterial hypertension. It is approved in Europe, Canada and the United States for use as a single agent to improve exercise ability and delay clinical worsening. In addition, it i... |
Categories: Acids, Carbocyclic Antihypertensive Agents Antihypertensives for Pulmonary Arterial Hypertension Cardiovascular Agents Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 Substrates Endothelin Receptor Antagonists Hypertension, Pulmonary OATP1B1/SLCO1B1 Substrates OATP1B3 substrates P-glycoprotein substrates UGT1A3 substrates UGT1A9 Substrates UGT2B7 substrates Vasodilating Agents
Cross-references: BindingDB: 50146710 ChEBI: 135949 CHEMBL1111 ChemSpider: 5293690 Drugs Product Database (DPD): 13310 PDB: A1D5J PharmGKB: PA165860521 PubChem:6918493 PubChem:310264868 RxCUI: 358274 Wikipedia: Ambrisentan ZINC: ZINC000000538627
Target Activities (2)
DrugBank Target Actions (11)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O60656 | O60656 | UDP-glucuronosyltransferase 1A9 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P35503 | P35503 | UDP-glucuronosyltransferase 1A3 | substrate | enzymes |
| P24530 | EDNRB | Endothelin receptor type B | antagonist | targets |
| P25101 | EDNRA | Endothelin-1 receptor | antagonist | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q9NPD5 | SLCO1B3 | Solute carrier organic anion transporter family member 1B3 | substrate | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | substrate | transporters |