Molecule Details
| InChIKey | OTDGPKRCQXSTPV-JTQLQIEISA-N |
|---|---|
| Compound Name | UK 396082 |
| Canonical SMILES | CCCn1cnc(C[C@H](CCCN)C(=O)O)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.25 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12099 |
|---|---|
| Drug Name | UK-396,082 |
| CAS Number | 400044-47-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | UK-396,082 has been used in trials studying the basic science of Safety, Phase 1, Toleration, Multiple Dose, and Pharmacokinetic. |
Categories: Amino Acids, Peptides, and Proteins
Cross-references: BindingDB: 50226610 CHEMBL398110 ChemSpider: 9416945 PDB: 720 PubChem:11241908 PubChem:347828403 ZINC: ZINC000001910640
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q96IY4 | CPB2 | Carboxypeptidase B2 | inhibitor | targets |