Molecule Details
| InChIKey | ORRNXRYWGDUDOG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pamufetinib |
| Canonical SMILES | CNC(=O)c1cc2c(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)ccnc2cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.02 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20752 |
|---|---|
| Drug Name | Pamufetinib |
| CAS Number | 1190836-34-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Pamufetinib is a small molecule drug. The usage of the INN stem '-tinib' in the name indicates that Pamufetinib is a tyrosine kinase inhibitor. Pamufetinib is under investigation in clinical trial NCT04999761 (AB122 Platform Study). Pamufetinib has a monoisotopic molecular weight of 518.14 Da. |
Categories: Amides Heterocyclic Compounds, Fused-Ring Sulfur Compounds
Cross-references: BindingDB: 50146163 CHEMBL3764045 ZINC: ZINC000115306389
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P16234 | PDGFRA | Homo sapiens | Human | PF07679 PF25305 PF07714 | 9.1 | IC50 | ChEMBL |
| P09619 | PDGFRB | Homo sapiens | Human | PF00047 PF13927 PF25305 PF07714 | 8.2 | IC50 | ChEMBL |
| P30530 | AXL | Homo sapiens | Human | PF00041 PF13927 PF07714 | 7.8 | IC50 | ChEMBL |
| P35968 | KDR | Homo sapiens | Human | PF07679 PF00047 PF13895 PF22971 PF07714 PF21339 PF17988 PF22854 | 7.5 | IC50 | ChEMBL;BindingDB |
| P08581 | MET | Homo sapiens | Human | PF07714 PF01437 PF01403 PF01833 | 7.5 | IC50 | ChEMBL;BindingDB |