Molecule Details
| InChIKey | OQLKNTOKMBVBKV-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | N=C(N)c1ccc(OCCCCCCOc2ccc(C(=N)N)cc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.34 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB03808 |
|---|---|
| Drug Name | Hexamidine |
| CAS Number | 3811-75-4 |
| Groups | approved investigational |
| ATC Codes | S03AA05 D08AC04 R02AA18 R01AX07 S01AX08 |
| Description | nan |
Categories: Amidines Anti-Infective Agents Anti-Infective Agents, Local Antiseptics and Disinfectants Biguanides and Amidines Dermatologicals Nasal Preparations Ophthalmological and Otological Preparations Ophthalmologicals Sensory Organs Throat Preparations
Cross-references: BindingDB: 50015234 ChEBI: 87184 CHEMBL25105 ChemSpider: 58639 Drugs Product Database (DPD): 4164 PDB: DID PubChem:65130 PubChem:46505102 RxCUI: 26849 Wikipedia: Hexamidine ZINC: ZINC000001705403