Molecule Details
| InChIKey | ONPGOSVDVDPBCY-CQSZACIVSA-N |
|---|---|
| Canonical SMILES | C[C@@H](Oc1cc(C(=O)Nc2ccc(C(=O)N3CCN(C)CC3)cc2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.04 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13104 |
|---|---|
| Drug Name | X-376 |
| CAS Number | 1365267-27-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | X-376 is an inhibitor of the anaplastic lymphoma kinase (ALK) which can penetrate the blood brain barrier.[A265085] |
Categories: Antineoplastic Agents Enzyme Inhibitors Protein Kinase Inhibitors
Cross-references: BindingDB: 50432894 CHEMBL2376648 ChemSpider: 30811339 PubChem:56960447 PubChem:347829228 ZINC: ZINC000096258164
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9UM73 | ALK | ALK tyrosine kinase receptor | inhibitor | targets |