Molecule Details
| InChIKey | ONBSHRSJOPSEGS-INIZCTEOSA-N |
|---|---|
| Canonical SMILES | CS(=O)(=O)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1[C@H](O)C(F)(F)C2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.31 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16055 |
|---|---|
| Drug Name | PT-2385 |
| CAS Number | 1672665-49-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | PT-2385 is under investigation in clinical trial NCT03108066 (PT2385 for the Treatment of Von Hippel-lindau Disease-associated Clear Cell Renal Cell Carcinoma). |
Categories: Indenes Sulfur Compounds
Cross-references: CHEMBL4173075 ChemSpider: 35308226 PDB: 79A ZINC: ZINC000230453533