Molecule Details
| InChIKey | OMFXVFTZEKFJBZ-HJTSIMOOSA-N |
|---|---|
| Compound Name | Corticosterone |
| Canonical SMILES | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)CO |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.51 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04652 |
|---|---|
| Drug Name | Corticosterone |
| CAS Number | 50-22-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | An adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. (From Goodman and Gilman's The Pharmacological Basis of Therapeutics, 8th ed, p1437) |
Categories: 11-Hydroxycorticosteroids Adrenal Cortex Hormones Anti-Inflammatory Agents Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Fused-Ring Compounds Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Hydroxycorticosteroids Pregnanes Pregnenediones Pregnenes Steroids
Cross-references: BindingDB: 50170653 ChEBI: 16827 CHEMBL110739 ChemSpider: 5550 C02140 PDB: C0R PubChem:5753 PubChem:46504547 Wikipedia: Corticosterone ZINC: ZINC000013513592
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08235 | NR3C2 | Homo sapiens | Human | PF00104 PF00105 | 9.3 | Kd | ChEMBL;BindingDB |
| P08185 | SERPINA6 | Homo sapiens | Human | PF00079 | 7.9 | Ki | ChEMBL;BindingDB |
| O75751 | SLC22A3 | Homo sapiens | Human | PF07690 | 6.5 | IC50 | ChEMBL;BindingDB |
| P04278 | SHBG | Homo sapiens | Human | PF00054 | 6.3 | Kd | ChEMBL;BindingDB |
DrugBank Target Actions (9)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | product of | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | substrate | enzymes |
| P80365 | HSD11B2 | 11-beta-hydroxysteroid dehydrogenase type 2 | substrate | enzymes |
| P04150 | NR3C1 | Glucocorticoid receptor | agonist | targets |
| Q15788 | NCOA1 | Nuclear receptor coactivator 1 | binder | targets |
| P08235 | NR3C2 | Mineralocorticoid receptor | inhibitor | targets |
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | product of | targets |
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | substrate | targets |