Molecule Details
| InChIKey | OLUJSZLBWZWGJT-HGBKYHTQSA-N |
|---|---|
| Compound Name | Nolasiban |
| Canonical SMILES | CO/N=C1/C[C@@H](CO)N(C(=O)c2ccc(-c3ccccc3C)cc2)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.75 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16259 |
|---|---|
| Drug Name | Nolasiban |
| CAS Number | 1477482-19-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Nolasiban is under investigation in clinical trial NCT03081208 (Phase 3 Placebo Controlled Study of Nolasiban to Improve Pregnancy Rates in Women Undergoing IVF/ICSI). |
Categories: Amines Hydroxylamines
Cross-references: CHEMBL1254025 ChemSpider: 26350515 ZINC: ZINC000064491763