Molecule Details
| InChIKey | OLIMBXKACVCIMM-HNNXBMFYSA-N |
|---|---|
| Compound Name | Atuzaginstat |
| Canonical SMILES | NCCCC[C@H](NC(=O)C1CCCC1)C(=O)COc1c(F)ccc(F)c1F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.53 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19030 |
|---|---|
| Drug Name | Atuzaginstat |
| CAS Number | 2211981-76-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Atuzaginstat is under investigation in clinical trial NCT03823404 (GAIN Trial: Phase 2/3 Study of COR388 in Subjects With Alzheimer's Disease). |
Cross-references: BindingDB: 453275 CHEMBL5095230 ChemSpider: 115037232