Molecule Details
| InChIKey | OIZSVTOIBNSVOS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dsm-265 |
| Canonical SMILES | Cc1cc(Nc2ccc(S(F)(F)(F)(F)F)cc2)n2nc(C(C)(F)F)nc2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.63 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12397 |
|---|---|
| Drug Name | DSM-265 |
| CAS Number | 1282041-94-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | DSM265 has been used in trials studying the prevention and treatment of Malaria. |
Cross-references: BindingDB: 50365230 CHEMBL1956285 ChemSpider: 28498407 PDB: D65 PubChem:51347395 PubChem:347828643 ZINC: ZINC000073311109