Molecule Details
| InChIKey | OIJXLIIMXHRJJH-KNLIIKEYSA-N |
|---|---|
| Compound Name | Diprenorphine |
| Canonical SMILES | CO[C@]12CC[C@@]3(C[C@@H]1C(C)(C)O)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1CC1CC1)[C@H]2O5 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01548 |
|---|---|
| Drug Name | Diprenorphine |
| CAS Number | 14357-78-9 |
| Groups | illicit investigational vet_approved |
| ATC Codes | nan |
| Description | A narcotic antagonist similar in action to naloxone. It is used to remobilize animals after etorphine neuroleptanalgesia and is considered a specific antagonist to etorphine. [PubChem] |
Categories: Alkaloids Central Nervous System Agents Heterocyclic Compounds, Fused-Ring Morphinans Opiate Alkaloids Opioid Antagonists Peripheral Nervous System Agents Phenanthrenes Sensory System Agents
Cross-references: BindingDB: 50001714 ChEBI: 4650 CHEMBL281786 ChemSpider: 391634 Drugs Product Database (DPD): 20253 Guide to Pharmacology: 1617 IUPHAR: 1617 C11794 PubChem:443408 PubChem:46506559 Wikipedia: Diprenorphine ZINC: ZINC000004102215