Molecule Details
| InChIKey | OHIUQAZROSYCMC-CALCHBBNSA-N |
|---|---|
| Canonical SMILES | Cc1ccc(O)c(C(=O)N[C@H]2CC[C@@H](NC(=O)c3cc(F)cnc3Oc3ccc(F)c(F)c3)CC2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.38 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12837 |
|---|---|
| Drug Name | UK-500001 |
| CAS Number | 582332-31-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | UK-500,001 has been used in trials studying the treatment of Pulmonary Disease, Chronic Obstructive. |
Cross-references: BindingDB: 50017340 CHEMBL3113734 ChemSpider: 31136578 PubChem:9876393 PubChem:347829002