Molecule Details
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Oxaprozin |
| Canonical SMILES | O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.43 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00991 |
|---|---|
| Drug Name | Oxaprozin |
| CAS Number | 21256-18-8 |
| Groups | approved |
| ATC Codes | M01AE12 |
| Description | Oxaprozin is a non-narcotic, non-steroidal anti-inflammatory drug (NSAID), used to relieve the inflammation, swelling, stiffness, and joint pain associated with osteoarthritis and rheumatoid arthritis. |
Categories: Acids, Acyclic Agents causing hyperkalemia Agents that produce hypertension Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Anti-Inflammatory Agents, Non-Steroidal (Non-Selective) Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents Arylpropionic acid NSAIDS Cyclooxygenase Inhibitors Drugs causing inadvertant photosensitivity Drugs that are Mainly Renally Excreted Enzyme Inhibitors Musculo-Skeletal System Nephrotoxic agents Non COX-2 selective NSAIDS Other Nonsteroidal Anti-inflammatory Agents Oxazoles Peripheral Nervous System Agents Photosensitizing Agents Propionates Sensory System Agents
Cross-references: BindingDB: 50002861 ChEBI: 7822 CHEMBL1071 ChemSpider: 4453 Drugs Product Database (DPD): 1863 C07356 D00463 PDB: BJ6 PharmGKB: PA450730 PubChem:4614 PubChem:46506429 RxCUI: 32613 Therapeutic Targets Database: DAP000622 Wikipedia: Oxaprozin ZINC: ZINC000049643479
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 7.0 | IC50 | ChEMBL;BindingDB |
| P01031 | C5 | Homo sapiens | Human | PF00207 PF07703 PF07677 PF01821 PF21309 PF17790 PF01835 PF17791 PF17789 PF01759 PF07678 | 6.2 | Kd | ChEMBL;BindingDB |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | 6.1 | IC50 | ChEMBL;BindingDB |