Molecule Details
| InChIKey | OFJRNBWSFXEHSA-UHFFFAOYSA-N |
|---|---|
| Compound Name | Razaxaban |
| Canonical SMILES | CN(C)Cc1nccn1-c1ccc(NC(=O)c2cc(C(F)(F)F)nn2-c2ccc3onc(N)c3c2)c(F)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.0 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19834 |
|---|---|
| Drug Name | Razaxaban |
| CAS Number | 218298-21-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Razaxaban is a small molecule drug. The usage of the INN stem '-xaban' in the name indicates that Razaxaban is a blood coagulation factor XA inhibitor, antithrombotic. Razaxaban has a monoisotopic molecular weight of 528.16 Da. |
Cross-references: BindingDB: 12676 CHEMBL206335 PDB: IK8 ZINC: ZINC000003633839