Molecule Details
| InChIKey | OFAIGZWCDGNZGT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Caramiphen |
| Canonical SMILES | CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.64 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11504 |
|---|---|
| Drug Name | Caramiphen |
| CAS Number | 77-22-5 |
| Groups | experimental vet_approved |
| ATC Codes | nan |
| Description | Caramiphen is a cholinergic antagonist used in Parkinson's disease. Additionally, it is used, in combination with [phenylpropanolamine], as a cough suppressant and nasal decongestant for the symptomatic treatment of seasonal respiratory conditions. |
Categories: Cycloparaffins
Cross-references: BindingDB: 73402 ChEBI: 135204 CHEMBL61946 ChemSpider: 6228 RxCUI: 20191 Wikipedia: Caramiphen ZINC: ZINC000001847743