Molecule Details
| InChIKey | OCKIPDMKGPYYJS-ZDUSSCGKSA-N |
|---|---|
| Compound Name | Azd0328 |
| Canonical SMILES | c1cnc2c(c1)C[C@@]1(CN3CCC1CC3)O2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.54 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12145 |
|---|---|
| Drug Name | AZD-0328 |
| CAS Number | 220099-91-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD0328 has been used in trials studying the treatment and basic science of Schizophrenia and Alzheimer's Disease. |
Categories: Receptors, Nicotinic
Cross-references: BindingDB: 50393243 CHEMBL2151437 ChemSpider: 7970159 PubChem:9794392 PubChem:347828441 ZINC: ZINC000033961869
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P36544 | CHRNA7 | Homo sapiens | Human | PF02931 PF02932 | 8.5 | Ki | ChEMBL;BindingDB |
| P46098 | HTR3A | Homo sapiens | Human | PF02931 PF02932 | 7.9 | Ki | ChEMBL;BindingDB |
| P17787 | CHRNB2 | Homo sapiens | Human | PF02931 PF02932 | 6.8 | Ki | ChEMBL |
| P43681 | CHRNA4 | Homo sapiens | Human | PF02931 PF02932 | 6.8 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P36544 | CHRNA7 | Neuronal acetylcholine receptor subunit alpha-7 | modulator | targets |