Molecule Details
| InChIKey | OCKGFTQIICXDQW-ZEQRLZLVSA-N |
|---|---|
| Compound Name | Mk-7145 |
| Canonical SMILES | Cc1c([C@@H](O)CN2CCN(C[C@H](O)c3ccc4c(c3C)COC4=O)CC2)ccc2c1COC2=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.49 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11968 |
|---|---|
| Drug Name | MK-7145 |
| CAS Number | 1255204-84-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | MK-7145 has been used in trials studying the treatment of Hypertension and Renal Insufficiency. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 155921 CHEMBL3696475 ChemSpider: 28424179 PubChem:59568713 PubChem:347828292