Molecule Details
| InChIKey | NZQDWKCNBOELAI-KSFYIVLOSA-N |
|---|---|
| Canonical SMILES | O=C(O)c1ccc(C(F)(F)F)cc1-c1ccc2c(c1)OC[C@H](Cc1ccccc1)[C@H]2O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.02 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13053 |
|---|---|
| Drug Name | CP-195543 |
| CAS Number | 204981-48-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CP-195,543 has been used in trials studying the treatment of Arthritis, Rheumatoid. |
Categories: Benzopyrans Heterocyclic Compounds, Fused-Ring Pyrans
Cross-references: BindingDB: 50215854 CHEMBL301829 ChemSpider: 7999633 PubChem:9823886 PubChem:347829182
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q15722 | LTB4R | Leukotriene B4 receptor 1 | antagonist | targets |