Molecule Details
| InChIKey | NVWCZRPXYVDQEE-UHFFFAOYSA-N |
|---|---|
| Compound Name | Azd-6280 |
| Canonical SMILES | CCCNC(=O)c1nnc2c(-c3cc(OC)ccc3OC)cccc2c1N |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.25 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12210 |
|---|---|
| Drug Name | AZD-6280 |
| CAS Number | 942436-93-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD6280 has been used in trials studying the basic science of Anxiety. |
Categories: Heterocyclic Compounds, Fused-Ring Receptors, Opioid, delta, agonists
Cross-references: BindingDB: 50418456 CHEMBL1783256 ChemSpider: 26343053 PubChem:23630026 PubChem:347828492 ZINC: ZINC000071295757
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | Ki | ChEMBL;BindingDB |
| P34903 | GABRA3 | Homo sapiens | Human | PF02931 PF02932 | 8.5 | Ki | ChEMBL;BindingDB |
| P47869 | GABRA2 | Homo sapiens | Human | PF02931 PF02932 | 8.1 | Ki | ChEMBL;BindingDB |
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 7.7 | Ki | ChEMBL |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 7.7 | Ki | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P34903 | GABRA3 | Gamma-aminobutyric acid receptor subunit alpha-3 | modulator | targets |