Molecule Details
| InChIKey | NUZWLKWWNNJHPT-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | O=C1c2c(O)cccc2Cc2cccc(O)c21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.82 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11157 |
|---|---|
| Drug Name | Anthralin |
| CAS Number | 1143-38-0 |
| Groups | approved |
| ATC Codes | D05AC01 D05AC51 |
| Description | Anthralin (1,8‐dihydroxy‐9anthrone, dithranol) is an older anti-psoriatic agent that was first synthesized as a derivative of chrysarobin, obtained from the araroba tree in Brazil over 100 years ago. Adverse effects of anthralin include irritation and discoloration of the skin [A27277]. This specifi... |
Categories: Anthracenes Antipsoriatics Antipsoriatics for Topical Use Antracen Derivatives Dermatologicals
Cross-references: BindingDB: 50041802 ChEBI: 37510 CHEMBL46469 ChemSpider: 2117 Drugs Product Database (DPD): 9362 C06831 PubChem:2202 PubChem:347827926 RxCUI: 873 Wikipedia: Dithranol ZINC: ZINC000000001322