Molecule Details
| InChIKey | NTNWOCRCBQPEKQ-YFKPBYRVSA-N |
|---|---|
| Compound Name | Ng-monomethyl-l-arginine |
| Canonical SMILES | CNC(=N)NCCC[C@H](N)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11815 |
|---|---|
| Drug Name | Tilarginine |
| CAS Number | 17035-90-4 |
| Groups | approved investigational withdrawn |
| ATC Codes | nan |
| Description | Tilarginine has been investigated for the basic science, treatment, and diagnostic of Obesity, Type 2 Diabetes, Ocular Physiology, and Regional Blood Flow. |
Categories: Amino Acids Amino Acids, Basic Amino Acids, Diamino Amino Acids, Peptides, and Proteins Arginine Enzyme Inhibitors Nitric Oxide Synthase, antagonists & inhibitors
Cross-references: BindingDB: 92900 ChEBI: 60257 CHEMBL256147 ChemSpider: 117259 C03884 PDB: NMM PubChem:132862 PubChem:347828162 Wikipedia: Methylarginine ZINC: ZINC000001529776
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P29474 | NOS3 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 | 6.3 | IC50 | ChEMBL;BindingDB |
| P35228 | NOS2 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 | 6.3 | IC50 | ChEMBL;BindingDB |
| P29475 | NOS1 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 PF00595 | 6.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P29474 | NOS3 | Nitric oxide synthase 3 | modulator | targets |